CAS 39942-44-4 appears in our catalog under these names: 4-Amino-3,5-dimethylphenyl acetate, 97%, 4-Acetoxy-2,6-xylidine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg.
(4-amino-3,5-dimethylphenyl) acetate (CAS 39942-44-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (4-amino-3,5-dimethylphenyl) acetate. InChIKey: REJOKVIJMOKWPZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (4-amino-3,5-dimethylphenyl) acetate |
| InChIKey | REJOKVIJMOKWPZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)OC(=O)C |
Computed by PubChem (NCBI)