CAS 39948-18-0 is the registry number for Methyldopa EP Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid (CAS 39948-18-0) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid. InChIKey: QCCQWLWXLUTSAK-LBPRGKRZSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid |
| InChIKey | QCCQWLWXLUTSAK-LBPRGKRZSA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)OC)OC)(C(=O)O)N |
Computed by PubChem (NCBI)