Products 39948-18-0

CAS 39948-18-0 is the registry number for Methyldopa EP Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid (CAS 39948-18-0) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid. InChIKey: QCCQWLWXLUTSAK-LBPRGKRZSA-N.

Identity
Molecular formulaC12H17NO4
Molecular weight239.27 g/mol
IUPAC name(2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid
InChIKeyQCCQWLWXLUTSAK-LBPRGKRZSA-N
SMILESC[C@](CC1=CC(=C(C=C1)OC)OC)(C(=O)O)N

Computed by PubChem (NCBI)