Products 40010-58-0
CAS 40010-58-0 is the registry number for 1,2-O-Isopropylidene-β-L-idofuranuronic-6-13C acid γ-lactone. Offered by: Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 2g, 500mg, 1 mg.
(1S,2R,6R,8R,9R)-9-hydroxy-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (CAS 40010-58-0) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 217.18 g/mol. IUPAC name: (1S,2R,6R,8R,9R)-9-hydroxy-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one. InChIKey: BDBGJSXZKMTMGP-OTDPURCDSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | (1S,2R,6R,8R,9R)-9-hydroxy-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| InChIKey | BDBGJSXZKMTMGP-OTDPURCDSA-N |
| SMILES | CC1(O[C@@H]2[C@@H]3[C@@H]([C@H]([13C](=O)O3)O)O[C@@H]2O1)C |
Computed by PubChem (NCBI)