CAS 40017-58-1 is the registry number for 2-Amino-3-(2-chlorobenzoyl)thiophene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
(2-aminothiophen-3-yl)-(2-chlorophenyl)methanone (CAS 40017-58-1) is a chemical compound with the molecular formula C11H8ClNOS and a molecular weight of 237.71 g/mol. IUPAC name: (2-aminothiophen-3-yl)-(2-chlorophenyl)methanone. InChIKey: PYKUZKXKWBHTCO-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNOS |
|---|---|
| Molecular weight | 237.71 g/mol |
| IUPAC name | (2-aminothiophen-3-yl)-(2-chlorophenyl)methanone |
| InChIKey | PYKUZKXKWBHTCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(SC=C2)N)Cl |
Computed by PubChem (NCBI)