Products 857283-93-3

CAS 857283-93-3 is the registry number for 4-(2-Methyl-1,3-thiazol-4-yl)benzoyl chloride, Tech. . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.

Structural formula: {0} (CAS {1})

4-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride (CAS 857283-93-3) is a chemical compound with the molecular formula C11H8ClNOS and a molecular weight of 237.71 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride. InChIKey: WJQGMUPBMHWAEX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClNOS
Molecular weight237.71 g/mol
IUPAC name4-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride
InChIKeyWJQGMUPBMHWAEX-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)C2=CC=C(C=C2)C(=O)Cl

Computed by PubChem (NCBI)