CAS 857283-93-3 is the registry number for 4-(2-Methyl-1,3-thiazol-4-yl)benzoyl chloride, Tech. . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
4-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride (CAS 857283-93-3) is a chemical compound with the molecular formula C11H8ClNOS and a molecular weight of 237.71 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride. InChIKey: WJQGMUPBMHWAEX-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNOS |
|---|---|
| Molecular weight | 237.71 g/mol |
| IUPAC name | 4-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride |
| InChIKey | WJQGMUPBMHWAEX-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)