Products 41631-21-4
CAS 41631-21-4 is the registry number for (2-Amino-5-chlorophenyl)(thiophen-2-yl)methanone. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 2g.
(2-amino-5-chlorophenyl)-thiophen-2-ylmethanone (CAS 41631-21-4) is a chemical compound with the molecular formula C11H8ClNOS and a molecular weight of 237.71 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-thiophen-2-ylmethanone. InChIKey: PYOYAYUOWCTPNL-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNOS |
|---|---|
| Molecular weight | 237.71 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-thiophen-2-ylmethanone |
| InChIKey | PYOYAYUOWCTPNL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)