CAS 844891-05-0 is the registry number for 3-(2-Methyl thiazol-4-yl)-benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride (CAS 844891-05-0) is a chemical compound with the molecular formula C11H8ClNOS and a molecular weight of 237.71 g/mol. IUPAC name: 3-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride. InChIKey: HPNXILHANJPJMT-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNOS |
|---|---|
| Molecular weight | 237.71 g/mol |
| IUPAC name | 3-(2-methyl-1,3-thiazol-4-yl)benzoyl chloride |
| InChIKey | HPNXILHANJPJMT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)