CAS 400877-36-3 appears in our catalog under these names: {(1-(3-chlorophenyl)-1H-pyrazol-4-yl)methyl}(methyl)amine, 95%, {(1-(3-Chlorophenyl)-1H-pyrazol-4-yl)methyl}(methyl)amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-[1-(3-chlorophenyl)pyrazol-4-yl]-N-methylmethanamine (CAS 400877-36-3) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: 1-[1-(3-chlorophenyl)pyrazol-4-yl]-N-methylmethanamine. InChIKey: JNHYNAWFDARSOO-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 1-[1-(3-chlorophenyl)pyrazol-4-yl]-N-methylmethanamine |
| InChIKey | JNHYNAWFDARSOO-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(N=C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)