CAS 40106-63-6 is the registry number for 4-Chloro-5,6,7,8,9,10-hexahydrocycloocta[4,5]thieno[2,3-d]pyrimidine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-8-thia-4,6-diazatricyclo[7.6.0.02,7]pentadeca-1(9),2(7),3,5-tetraene (CAS 40106-63-6) is a chemical compound with the molecular formula C12H13ClN2S and a molecular weight of 252.76 g/mol. IUPAC name: 3-chloro-8-thia-4,6-diazatricyclo[7.6.0.02,7]pentadeca-1(9),2(7),3,5-tetraene. InChIKey: NBBHKKDRRIZXCT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2S |
|---|---|
| Molecular weight | 252.76 g/mol |
| IUPAC name | 3-chloro-8-thia-4,6-diazatricyclo[7.6.0.02,7]pentadeca-1(9),2(7),3,5-tetraene |
| InChIKey | NBBHKKDRRIZXCT-UHFFFAOYSA-N |
| SMILES | C1CCCC2=C(CC1)C3=C(S2)N=CN=C3Cl |
Computed by PubChem (NCBI)