Products 867311-51-1
CAS 867311-51-1 is the registry number for 3-Chloro-5-methyl-8-thia-4,6-diazatricyclo(7.5.0.0,2,7)tetradeca-1(9),2,4,6-tetraene. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-chloro-5-methyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene (CAS 867311-51-1) is a chemical compound with the molecular formula C12H13ClN2S and a molecular weight of 252.76 g/mol. IUPAC name: 3-chloro-5-methyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene. InChIKey: FCVCCAFFZXPKGV-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2S |
|---|---|
| Molecular weight | 252.76 g/mol |
| IUPAC name | 3-chloro-5-methyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene |
| InChIKey | FCVCCAFFZXPKGV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C3=C(S2)CCCCC3)C(=N1)Cl |
Computed by PubChem (NCBI)