CAS 885527-33-3 is the registry number for 5-Chloro-2-(piperidin-4-yl)-1,3-benzothiazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-chloro-2-piperidin-4-yl-1,3-benzothiazole (CAS 885527-33-3) is a chemical compound with the molecular formula C12H13ClN2S and a molecular weight of 252.76 g/mol. IUPAC name: 5-chloro-2-piperidin-4-yl-1,3-benzothiazole. InChIKey: RJJINACFKMZRQI-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2S |
|---|---|
| Molecular weight | 252.76 g/mol |
| IUPAC name | 5-chloro-2-piperidin-4-yl-1,3-benzothiazole |
| InChIKey | RJJINACFKMZRQI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=NC3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)