CAS 401511-17-9 is the registry number for 4-Chloro-2-ethyl-5,6,7,8-tetrahydrobenzo[b]thieno[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (CAS 401511-17-9) is a chemical compound with the molecular formula C12H13ClN2S and a molecular weight of 252.76 g/mol. IUPAC name: 4-chloro-2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine. InChIKey: DSIDAKPWUCMMND-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2S |
|---|---|
| Molecular weight | 252.76 g/mol |
| IUPAC name | 4-chloro-2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| InChIKey | DSIDAKPWUCMMND-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C3=C(S2)CCCC3)C(=N1)Cl |
Computed by PubChem (NCBI)