Products 40180-05-0
CAS 40180-05-0 is the registry number for (2,3-Dichloro-4-methoxyphenyl)-2-thienylmethanone. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
(2,3-dichloro-4-methoxyphenyl)-thiophen-2-ylmethanone (CAS 40180-05-0) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: (2,3-dichloro-4-methoxyphenyl)-thiophen-2-ylmethanone. InChIKey: LPOFCDCHMSXJDK-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | (2,3-dichloro-4-methoxyphenyl)-thiophen-2-ylmethanone |
| InChIKey | LPOFCDCHMSXJDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)C2=CC=CS2)Cl)Cl |
Computed by PubChem (NCBI)