CAS 401941-54-6 appears in our catalog under these names: (S)-1,4-Benzodioxan-2-carboxypiperazine, 98%, (S)-1,4-Benzodioxan-2-carboxypiperazine. Offered by: Combi-blocks, TRC. Available pack sizes: 25g, 5g, 1g, 100mg.
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-piperazin-1-ylmethanone (CAS 401941-54-6) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-piperazin-1-ylmethanone. InChIKey: FLUPDJNTYCSBJZ-LBPRGKRZSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-piperazin-1-ylmethanone |
| InChIKey | FLUPDJNTYCSBJZ-LBPRGKRZSA-N |
| SMILES | C1CN(CCN1)C(=O)[C@@H]2COC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)