CAS 1055974-00-9 appears in our catalog under these names: 1H-Indazole-1-carboxylic acid, 6-hydroxy-3-methyl-, 1,1-dimethylethyl ester, 95%, tert-Butyl 6-hydroxy-3-methyl-1H-indazole-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl 6-hydroxy-3-methylindazole-1-carboxylate (CAS 1055974-00-9) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: tert-butyl 6-hydroxy-3-methylindazole-1-carboxylate. InChIKey: XTNRROZRYDONDL-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | tert-butyl 6-hydroxy-3-methylindazole-1-carboxylate |
| InChIKey | XTNRROZRYDONDL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=CC(=C2)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)