CAS 62937-47-7 appears in our catalog under these names: Z-D-Pro-NH2, 98%, Z-D-Pro-Nh2, 97%, 97%, (R)-2-Carbamoyl-1-N-Cbz-pyrrolidine, 95%, Cbz-D-Pro-NH2, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg.
Benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate (CAS 62937-47-7) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate. InChIKey: ZCGHEBMEQXMRQL-LLVKDONJSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | ZCGHEBMEQXMRQL-LLVKDONJSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)