CAS 928653-83-2 appears in our catalog under these names: 5-Methoxy-pyrrolo[2,3-b]pyridine-1-carboxylic acid tert-butyl ester, 95%, tert-Butyl 5-methoxy-1H-pyrrolo(2,3-b)pyridine-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
Tert-butyl 5-methoxypyrrolo[2,3-b]pyridine-1-carboxylate (CAS 928653-83-2) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: tert-butyl 5-methoxypyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: VHFWDIPVJZAJHB-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | tert-butyl 5-methoxypyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | VHFWDIPVJZAJHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=CC(=CN=C21)OC |
Computed by PubChem (NCBI)