CAS 40216-62-4 is the registry number for Bzl-L-Val-OMe*HCl. Offered by: Creative Peptides. Available pack sizes: 5g, 25g.
Methyl (2S)-2-(benzylamino)-3-methylbutanoate (CAS 40216-62-4) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: methyl (2S)-2-(benzylamino)-3-methylbutanoate. InChIKey: LFUIOAXMANYSCA-LBPRGKRZSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | methyl (2S)-2-(benzylamino)-3-methylbutanoate |
| InChIKey | LFUIOAXMANYSCA-LBPRGKRZSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)