CAS 40217-17-2 appears in our catalog under these names: 4–benzyloxazolidin–2–one, 4-Benzyloxazolidin-2-one, 98%, 4-Benzyloxazolidin-2-one, 98+%, 98+%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g.
4-benzyl-1,3-oxazolidin-2-one (CAS 40217-17-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 4-benzyl-1,3-oxazolidin-2-one. InChIKey: OJOFMLDBXPDXLQ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 4-benzyl-1,3-oxazolidin-2-one |
| InChIKey | OJOFMLDBXPDXLQ-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)O1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)