Products 4023-82-9
CAS 4023-82-9 is the registry number for 1-(4-Nitrophenyl)butane-1,3-dione. Offered by: Biosynth. Available pack sizes: 10g, 1g.
1-(4-nitrophenyl)butane-1,3-dione (CAS 4023-82-9) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 1-(4-nitrophenyl)butane-1,3-dione. InChIKey: UUFHFNDYTYXICJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 1-(4-nitrophenyl)butane-1,3-dione |
| InChIKey | UUFHFNDYTYXICJ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
1-(4-nitrophenyl)butane-1,3-dione, 1,3-Butanedione, 1-(4-nitrophenyl)-, 1-(4-Nitrophenyl)-1,3-butanedione, 1,3-Butanedione, 1-(p-nitrophenyl)-, 4-07-00-02154 (Beilstein Handbook Reference), (p-Nitrobenzoyl)acetone, Benzoylacetone, p-nitro-, 1-(p-Nitrophenyl)-1,3-butanedione, 4-Nitrobenzoylacetone, 1, 1-(p-nitrophenyl)-