Products 40262-63-3
CAS 40262-63-3 appears in our catalog under these names: 6-(Pyrrolidin-1-yl)pyrazine-2-carboxylic acid, 6-(Pyrrolidin-1-yl)pyrazine-2-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 100mg.
6-pyrrolidin-1-ylpyrazine-2-carboxylic acid (CAS 40262-63-3) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: 6-pyrrolidin-1-ylpyrazine-2-carboxylic acid. InChIKey: FWCGWRFACFLWNM-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 6-pyrrolidin-1-ylpyrazine-2-carboxylic acid |
| InChIKey | FWCGWRFACFLWNM-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)