CAS 40318-20-5 is the registry number for (2-Aminophenyl)(phenyl)methanone hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-aminophenyl)-phenylmethanone;hydrochloride (CAS 40318-20-5) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: (2-aminophenyl)-phenylmethanone;hydrochloride. InChIKey: CPVYPYCGVPCKIX-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | (2-aminophenyl)-phenylmethanone;hydrochloride |
| InChIKey | CPVYPYCGVPCKIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2N.Cl |
Computed by PubChem (NCBI)