CAS 40371-50-4 appears in our catalog under these names: (S)-(+)-N-Carboxybenzoyl-4-Amino-2-hydroxybutyric Acid, (S)-N-Carbobenzyloxy-4-amino-2-hydroxybutyric acid, Cbz-HABA-OH 97%, (S)-N-Cbz-4-Amino-2-Hydroxybutyric Acid, 97%, 97%, (S)-N-Cbz-4-amino-2-hydroxybutyric acid, 97%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250g, 100g, 1g, 10g, 25g, 50g.
(2S)-2-hydroxy-4-(phenylmethoxycarbonylamino)butanoic acid (CAS 40371-50-4) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: (2S)-2-hydroxy-4-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: ULKOBRDRCYROKY-JTQLQIEISA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | (2S)-2-hydroxy-4-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | ULKOBRDRCYROKY-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)