Products 404009-18-3
CAS 404009-18-3 appears in our catalog under these names: 2-Nitro-5-thiomorpholinoaniline, 95%, 95%, 2-Nitro-5-(thiomorpholin-4-yl)aniline. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-nitro-5-thiomorpholin-4-ylaniline (CAS 404009-18-3) is a chemical compound with the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. IUPAC name: 2-nitro-5-thiomorpholin-4-ylaniline. InChIKey: ULKCUKDARNAGSB-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2S |
|---|---|
| Molecular weight | 239.30 g/mol |
| IUPAC name | 2-nitro-5-thiomorpholin-4-ylaniline |
| InChIKey | ULKCUKDARNAGSB-UHFFFAOYSA-N |
| SMILES | C1CSCCN1C2=CC(=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)