CAS 40512-57-0 appears in our catalog under these names: N-Boc-amino-(3-thienyl)acetic acid, 95%, 2–(Boc–amino)–2–(3–thiophenyl)acetic acid, 2-(Boc-amino)-2-(3-thiophenyl)acetic acid, N-BOC-AMINO-(3-THIENYL)ACETIC ACID, >97%, >97%, 2-(BOC-AMINO)-2-(3-THIOPHENYL)ACETIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 0,5g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-3-ylacetic acid (CAS 40512-57-0) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-3-ylacetic acid. InChIKey: VJYLMXXKPBZDHN-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-3-ylacetic acid |
| InChIKey | VJYLMXXKPBZDHN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CSC=C1)C(=O)O |
Computed by PubChem (NCBI)