CAS 910309-12-5 appears in our catalog under these names: (S)-{[(tert-butoxy)carbonyl]amino}(thiophen-3-yl)acetic acid, 95%, Boc–(S)–3–Thienylglycine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 10mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-3-ylacetic acid (CAS 910309-12-5) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-3-ylacetic acid. InChIKey: VJYLMXXKPBZDHN-QMMMGPOBSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-3-ylacetic acid |
| InChIKey | VJYLMXXKPBZDHN-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CSC=C1)C(=O)O |
Computed by PubChem (NCBI)