Products 4056-87-5
CAS 4056-87-5 appears in our catalog under these names: 2,2-Dimethyl-3-phenylcyclobutan-1-one, 98%, 2,2-Dimethyl-3-phenylcyclobutan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-dimethyl-3-phenylcyclobutan-1-one (CAS 4056-87-5) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 2,2-dimethyl-3-phenylcyclobutan-1-one. InChIKey: RQFJJICAYZMXDO-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 2,2-dimethyl-3-phenylcyclobutan-1-one |
| InChIKey | RQFJJICAYZMXDO-UHFFFAOYSA-N |
| SMILES | CC1(C(CC1=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)