Products 40563-28-8
CAS 40563-28-8 is the registry number for Cniforin A. Offered by: Biosynth. Available pack sizes: 1mg.
[(8S,9R)-8-(2-acetyloxypropan-2-yl)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-9-yl] 2-methylpropanoate (CAS 40563-28-8) is a chemical compound with the molecular formula C20H22O7 and a molecular weight of 374.4 g/mol. IUPAC name: [(8S,9R)-8-(2-acetyloxypropan-2-yl)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-9-yl] 2-methylpropanoate. InChIKey: GUWOWSAGEMNEHI-MSOLQXFVSA-N.
| Molecular formula | C20H22O7 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | [(8S,9R)-8-(2-acetyloxypropan-2-yl)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-9-yl] 2-methylpropanoate |
| InChIKey | GUWOWSAGEMNEHI-MSOLQXFVSA-N |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](OC2=C1C3=C(C=C2)C=CC(=O)O3)C(C)(C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Cniforin A