CAS 405872-78-8 appears in our catalog under these names: Apixaban Impurity 22, (Z)-Ethyl-2-chloro-2-(2-(3-methoxyphenyl)hydrazono)acetate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Ethyl (2Z)-2-chloro-2-[(3-methoxyphenyl)hydrazinylidene]acetate (CAS 405872-78-8) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: ethyl (2Z)-2-chloro-2-[(3-methoxyphenyl)hydrazinylidene]acetate. InChIKey: YVISHWWYVAIPNX-UVTDQMKNSA-N.
| Molecular formula | C11H13ClN2O3 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | ethyl (2Z)-2-chloro-2-[(3-methoxyphenyl)hydrazinylidene]acetate |
| InChIKey | YVISHWWYVAIPNX-UVTDQMKNSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC(=CC=C1)OC)/Cl |
Computed by PubChem (NCBI)