Products 406484-24-0
CAS 406484-24-0 is the registry number for JANEX-1-M. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-hydroxyanilino)-6-methoxyquinazolin-7-ol (CAS 406484-24-0) is a chemical compound with the molecular formula C15H13N3O3 and a molecular weight of 283.28 g/mol. IUPAC name: 4-(4-hydroxyanilino)-6-methoxyquinazolin-7-ol. InChIKey: WKTLTDLVYQTHFO-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O3 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 4-(4-hydroxyanilino)-6-methoxyquinazolin-7-ol |
| InChIKey | WKTLTDLVYQTHFO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)