CAS 406938-53-2 appears in our catalog under these names: (S)–2–Amino–3–(4–methoxy–1H–indol–3–yl)propanoic acid, (S)-2-Amino-3-(4-methoxy-1H-indol-3-yl)propanoic acid, 98%, 98%, H-Trp(4-OMe)-OH, 98%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-amino-3-(4-methoxy-1H-indol-3-yl)propanoic acid (CAS 406938-53-2) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: (2S)-2-amino-3-(4-methoxy-1H-indol-3-yl)propanoic acid. InChIKey: VYXPKRIKQJEAOO-QMMMGPOBSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-methoxy-1H-indol-3-yl)propanoic acid |
| InChIKey | VYXPKRIKQJEAOO-QMMMGPOBSA-N |
| SMILES | COC1=CC=CC2=C1C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)