CAS 40724-67-2 appears in our catalog under these names: (S)–(+)–Ketopinic Acid, (S)-(+)-Ketopinic Acid, >98.0%(GC)(T), (S)-(+)-Ketopinic Acid 98%, (1S)-(+)-KETOPINIC ACID, 99%, (S)-(+)-Ketopinic Acid, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g, 500mg, 2.5g.
(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid (CAS 40724-67-2) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: (1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid. InChIKey: WDODWBQJVMBHCO-LDWIPMOCSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | (1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid |
| InChIKey | WDODWBQJVMBHCO-LDWIPMOCSA-N |
| SMILES | CC1([C@@H]2CC[C@]1(C(=O)C2)C(=O)O)C |
Computed by PubChem (NCBI)