Products 64234-14-6

CAS 64234-14-6 is the registry number for (1R,4S)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(1R,4S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid (CAS 64234-14-6) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: (1R,4S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid. InChIKey: WDODWBQJVMBHCO-QUBYGPBYSA-N.

Identity
Molecular formulaC10H14O3
Molecular weight182.22 g/mol
IUPAC name(1R,4S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid
InChIKeyWDODWBQJVMBHCO-QUBYGPBYSA-N
SMILESCC1([C@H]2CC[C@@]1(C(=O)C2)C(=O)O)C

Computed by PubChem (NCBI)