CAS 40763-04-0 appears in our catalog under these names: 3,5,6-Trimethylbenzofuran-2-carboxylic acid, 97%, 97%, 3,5,6-Trimethylbenzofuran-2-carboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3,5,6-trimethyl-1-benzofuran-2-carboxylic acid (CAS 40763-04-0) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 3,5,6-trimethyl-1-benzofuran-2-carboxylic acid. InChIKey: VRTTTXHRPSGHSZ-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3,5,6-trimethyl-1-benzofuran-2-carboxylic acid |
| InChIKey | VRTTTXHRPSGHSZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)OC(=C2C)C(=O)O |
Computed by PubChem (NCBI)