CAS 40795-94-6 appears in our catalog under these names: 5-(6-Methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione, 95%, 5-(6-Methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione (CAS 40795-94-6) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: 5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione. InChIKey: UONGVWKSHLMDJS-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione |
| InChIKey | UONGVWKSHLMDJS-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC3=C(C=C2)C=C(C=C3)OC |
Computed by PubChem (NCBI)