Products 40800-65-5
CAS 40800-65-5 appears in our catalog under these names: Ethyl 4–amino–3–methylbenzoate, Ethyl 4-amino-3-methylbenzoate, Ethyl 4-amino-3-methylbenzoate 98%, Ethyl 4-amino-3-methylbenzoate, 98%, 98%, Ethyl-4-amino-3-methylbenzoate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 2,5g, 0,25g, 1g, 5g, 25g, 500g.
Ethyl 4-amino-3-methylbenzoate (CAS 40800-65-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: ethyl 4-amino-3-methylbenzoate. InChIKey: JUKRQDBAJXYXIR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | ethyl 4-amino-3-methylbenzoate |
| InChIKey | JUKRQDBAJXYXIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)C |
Computed by PubChem (NCBI)