CAS 4083-85-6 appears in our catalog under these names: Ethyl 2–(bromotriphenyl–l5–phosphanyl)acetate, Triphenyl(carbethoxymethyl)phosphonium bromide, 97%, 97%, Triphenyl(carbethoxymethyl)phosphonium bromide, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g.
Ethyl 2-[bromo(triphenyl)-lambda5-phosphanyl]acetate (CAS 4083-85-6) is a chemical compound with the molecular formula C22H22BrO2P and a molecular weight of 429.3 g/mol. IUPAC name: ethyl 2-[bromo(triphenyl)-lambda5-phosphanyl]acetate. InChIKey: UYMZZYLECILSGL-UHFFFAOYSA-N.
| Molecular formula | C22H22BrO2P |
|---|---|
| Molecular weight | 429.3 g/mol |
| IUPAC name | ethyl 2-[bromo(triphenyl)-lambda5-phosphanyl]acetate |
| InChIKey | UYMZZYLECILSGL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CP(C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)Br |
Computed by PubChem (NCBI)