CAS 408322-08-7 appears in our catalog under these names: 2-benzylindazol-3-amine, 95%, 2-benzylindazol-3-amine, 96%, 96%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
2-benzylindazol-3-amine (CAS 408322-08-7) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 2-benzylindazol-3-amine. InChIKey: YGYMIVLVWCXRFH-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2-benzylindazol-3-amine |
| InChIKey | YGYMIVLVWCXRFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C3C=CC=CC3=N2)N |
Computed by PubChem (NCBI)