CAS 408335-66-0 is the registry number for Tyrosinase-IN-29. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-6-methyl-1H-quinolin-2-one (CAS 408335-66-0) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 3-hydroxy-6-methyl-1H-quinolin-2-one. InChIKey: HHBIREFHPDVOQC-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 3-hydroxy-6-methyl-1H-quinolin-2-one |
| InChIKey | HHBIREFHPDVOQC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)C(=C2)O |
Computed by PubChem (NCBI)