CAS 40851-66-9 appears in our catalog under these names: 2-(Boc-aminomethyl)phenylacetic acid, 97%, Boc-2-AM-PhAcOH, 2-(Boc-aminomethyl)phenylacetic Acid 97%, 2-(2-(((tert-butoxycarbonyl)amino)methyl)phenyl)acetic acid, 97%, 97%, 2-(2-(((tert-Butoxycarbonyl)amino)methyl)phenyl)acetic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
2-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]acetic acid (CAS 40851-66-9) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 2-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]acetic acid. InChIKey: CGPQRFCFBISLKF-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 2-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]acetic acid |
| InChIKey | CGPQRFCFBISLKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=CC=C1CC(=O)O |
Computed by PubChem (NCBI)