Products 40851-96-5
CAS 40851-96-5 appears in our catalog under these names: 5-Chloro-2-(trifluoromethyl)-3H-imidazo[4,5-b]pyridine, 98%, 98%, 5-chloro-2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine (CAS 40851-96-5) is a chemical compound with the molecular formula C7H3ClF3N3 and a molecular weight of 221.57 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine. InChIKey: JIFFIOLNCXHOHH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3 |
|---|---|
| Molecular weight | 221.57 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine |
| InChIKey | JIFFIOLNCXHOHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)