CAS 40945-68-4 is the registry number for Arbidol Impurity 45. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-bromo-5-hydroxy-1,2-dimethylindole-3-carboxylate (CAS 40945-68-4) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: ethyl 6-bromo-5-hydroxy-1,2-dimethylindole-3-carboxylate. InChIKey: ASDKWGKYKLXCAQ-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | ethyl 6-bromo-5-hydroxy-1,2-dimethylindole-3-carboxylate |
| InChIKey | ASDKWGKYKLXCAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=CC(=C(C=C21)O)Br)C)C |
Computed by PubChem (NCBI)