Products 40945-68-4

CAS 40945-68-4 is the registry number for Arbidol Impurity 45. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 6-bromo-5-hydroxy-1,2-dimethylindole-3-carboxylate (CAS 40945-68-4) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: ethyl 6-bromo-5-hydroxy-1,2-dimethylindole-3-carboxylate. InChIKey: ASDKWGKYKLXCAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14BrNO3
Molecular weight312.16 g/mol
IUPAC nameethyl 6-bromo-5-hydroxy-1,2-dimethylindole-3-carboxylate
InChIKeyASDKWGKYKLXCAQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N(C2=CC(=C(C=C21)O)Br)C)C

Computed by PubChem (NCBI)