CAS 40946-46-1 appears in our catalog under these names: Propofol Impurity 4, Propofol Impurity 30. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-hydroxy-5-propan-2-ylbenzene-1,3-dicarboxylic acid (CAS 40946-46-1) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 4-hydroxy-5-propan-2-ylbenzene-1,3-dicarboxylic acid. InChIKey: VZLMFHBWWLENPY-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 4-hydroxy-5-propan-2-ylbenzene-1,3-dicarboxylic acid |
| InChIKey | VZLMFHBWWLENPY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)C(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)