CAS 4106-66-5 appears in our catalog under these names: Dibenzo(b,d)furan-3-amine, >95% (HPLC), Dibenzo(b,d)furan–3–amine, 3-Aminodibenzofuran 98%, Dibenzo[b,d]furan-3-amine, 98%, 98%, Dibenzofuran-3-ylamine, 98%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 25g, 500g, 1g, 5g, 10g.
Dibenzofuran-3-amine (CAS 4106-66-5) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: dibenzofuran-3-amine. InChIKey: GHQCIALFYKYZGS-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | dibenzofuran-3-amine |
| InChIKey | GHQCIALFYKYZGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)N |
Computed by PubChem (NCBI)