Products 41060-16-6
CAS 41060-16-6 appears in our catalog under these names: Skullcapflavone I, Skullcapflavone I, 99.30%, Panicolin, Skullcapflavone I, ≥98%(HPLC). Offered by: GLPBio, MedChemExpress, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 5 mg, 10MG, 5mg.
5-hydroxy-2-(2-hydroxyphenyl)-7,8-dimethoxychromen-4-one (CAS 41060-16-6) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 5-hydroxy-2-(2-hydroxyphenyl)-7,8-dimethoxychromen-4-one. InChIKey: CZRGNFVQUYWGKP-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 5-hydroxy-2-(2-hydroxyphenyl)-7,8-dimethoxychromen-4-one |
| InChIKey | CZRGNFVQUYWGKP-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=CC=CC=C3O)OC |
Computed by PubChem (NCBI)
Synonyms:
Skullcapflavone I, Panicolin, 5,2'-Dihydroxy-7,8-dimethoxyflavone, 5-hydroxy-2-(2-hydroxyphenyl)-7,8-dimethoxychromen-4-one, 2',5-Dihydroxy-7,8-dimethoxyflavone, 4H-1-Benzopyran-4-one, 5-hydroxy-2-(2-hydroxyphenyl)-7,8-dimethoxy-, Skullcapflavon I, SKULLCAPFLAVONEI, Scullcapflavone, orb1681673