CAS 41085-43-2 appears in our catalog under these names: 2–Bromo–3–nitrotoluene, 2-Bromo-3-nitrotoluene, 98%, 2-Bromo-3-nitrotoluene 98%, 2-Bromo-3-nitrotoluene, >98.0%(GC), 2-Bromo-3-nitrotoluene, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Fluorochem, TCI. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 500g, 1000g, 1kg.
2-bromo-1-methyl-3-nitrobenzene (CAS 41085-43-2) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 2-bromo-1-methyl-3-nitrobenzene. InChIKey: GCAAVRIWNMTOKB-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 2-bromo-1-methyl-3-nitrobenzene |
| InChIKey | GCAAVRIWNMTOKB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)