CAS 411233-14-2 appears in our catalog under these names: Resveratrol 3,5-diacetate, resveratrol 3,5–di–O–acetate, trans-Resveratrol 3,5-diacetate. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 25mg, 1g, 250mg, 100mg, 500mg.
[3-acetyloxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] acetate (CAS 411233-14-2) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: [3-acetyloxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] acetate. InChIKey: YBTSXNIAKDYGPK-ONEGZZNKSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | [3-acetyloxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] acetate |
| InChIKey | YBTSXNIAKDYGPK-ONEGZZNKSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)/C=C/C2=CC=C(C=C2)O)OC(=O)C |
Computed by PubChem (NCBI)