Products 412022-79-8
CAS 412022-79-8 is the registry number for 2-Chloro-1-(2-phenyl-1h-indol-3-yl)ethan-1-one, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-1-(2-phenyl-1H-indol-3-yl)ethanone (CAS 412022-79-8) is a chemical compound with the molecular formula C16H12ClNO and a molecular weight of 269.72 g/mol. IUPAC name: 2-chloro-1-(2-phenyl-1H-indol-3-yl)ethanone. InChIKey: QXRBUGZOPDWQSM-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 2-chloro-1-(2-phenyl-1H-indol-3-yl)ethanone |
| InChIKey | QXRBUGZOPDWQSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C(=O)CCl |
Computed by PubChem (NCBI)