CAS 41225-81-4 is the registry number for 3-Amino-1,2,3-benzotriazin-4-one. Offered by: TRC. Available pack sizes: 25mg.
3-amino-1,2,3-benzotriazin-4-one (CAS 41225-81-4) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 3-amino-1,2,3-benzotriazin-4-one. InChIKey: MGZUQDHNBYYFGF-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-amino-1,2,3-benzotriazin-4-one |
| InChIKey | MGZUQDHNBYYFGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(N=N2)N |
Computed by PubChem (NCBI)