CAS 412335-39-8 is the registry number for 4-Hydroxy-6,7-dimethoxyquinolin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one (CAS 412335-39-8) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one. InChIKey: FGPCWYCOKWFRNK-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one |
| InChIKey | FGPCWYCOKWFRNK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=O)N2)O)OC |
Computed by PubChem (NCBI)